C14H13N3O4S2 — CID 54750163
5,6,7,8-tetradeuterio-N-(4-deuterio-5-methyl-1,3-thiazol-2-yl)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide (PubChem CID 54750163) has the molecular formula C14H13N3O4S2 and a molecular weight of 356.44 g/mol. Its IUPAC name is 5,6,7,8-tetradeuterio-N-(4-deuterio-5-methyl-1,3-thiazol-2-yl)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide.
| Compound Name | 5,6,7,8-tetradeuterio-N-(4-deuterio-5-methyl-1,3-thiazol-2-yl)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 54750163 |
| Molecular Formula | C14H13N3O4S2 |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 5,6,7,8-tetradeuterio-N-(4-deuterio-5-methyl-1,3-thiazol-2-yl)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
| SMILES | [2H]c1nc(NC(=O)C2=C(O)c3c([2H])c([2H])c([2H])c([2H])c3S(=O)(=O)N2C)sc1C |
| InChI | InChI=1S/C14H13N3O4S2/c1-8-7-15-14(22-8)16-13(19)11-12(18)9-5-3-4-6-10(9)23(20,21)17(11)2/h3-7,18H,1-2H3,(H,15,16,19)/i3D,4D,5D,6D,7D |
| InChIKey | ZRVUJXDFFKFLMG-DKFMXDSJSA-N |
| XLogP | 1.95 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |