C13H11N3O4S2 — CID 71752364
4-hydroxy-2-methyl-1,1-dioxo-N-(3,4,5,6-tetradeuterio-2-pyridinyl)thieno[2,3-e]thiazine-3-carboxamide (PubChem CID 71752364) has the molecular formula C13H11N3O4S2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 4-hydroxy-2-methyl-1,1-dioxo-N-(3,4,5,6-tetradeuterio-2-pyridinyl)thieno[2,3-e]thiazine-3-carboxamide.
| Compound Name | 4-hydroxy-2-methyl-1,1-dioxo-N-(3,4,5,6-tetradeuterio-2-pyridinyl)thieno[2,3-e]thiazine-3-carboxamide |
|---|---|
| PubChem CID | 71752364 |
| Molecular Formula | C13H11N3O4S2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 4-hydroxy-2-methyl-1,1-dioxo-N-(3,4,5,6-tetradeuterio-2-pyridinyl)thieno[2,3-e]thiazine-3-carboxamide |
| SMILES | [2H]c1nc(NC(=O)C2=C(O)c3sccc3S(=O)(=O)N2C)c([2H])c([2H])c1[2H] |
| InChI | InChI=1S/C13H11N3O4S2/c1-16-10(13(18)15-9-4-2-3-6-14-9)11(17)12-8(5-7-21-12)22(16,19)20/h2-7,17H,1H3,(H,14,15,18)/i2D,3D,4D,6D |
| InChIKey | LZNWYQJJBLGYLT-UCSNGBFQSA-N |
| XLogP | 1.64 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |