C21H20O3S — CID 54752067
(7R)-7-(9H-thioxanthen-9-yl)-1,4-dioxaspiro[4.5]decan-8-one (PubChem CID 54752067) has the molecular formula C21H20O3S and a molecular weight of 352.45 g/mol. Its IUPAC name is (7R)-7-(9H-thioxanthen-9-yl)-1,4-dioxaspiro[4.5]decan-8-one.
| Compound Name | (7R)-7-(9H-thioxanthen-9-yl)-1,4-dioxaspiro[4.5]decan-8-one |
|---|---|
| PubChem CID | 54752067 |
| Molecular Formula | C21H20O3S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | (7R)-7-(9H-thioxanthen-9-yl)-1,4-dioxaspiro[4.5]decan-8-one |
| SMILES | O=C1CCC2(C[C@@H]1C1c3ccccc3Sc3ccccc31)OCCO2 |
| InChI | InChI=1S/C21H20O3S/c22-17-9-10-21(23-11-12-24-21)13-16(17)20-14-5-1-3-7-18(14)25-19-8-4-2-6-15(19)20/h1-8,16,20H,9-13H2/t16-/m0/s1 |
| InChIKey | ITTDXHQYQANZBZ-INIZCTEOSA-N |
| XLogP | 4.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |