C27H22O4S — CID 90750019
5-(2-phenylethyl)-3-[2-(9H-thioxanthen-9-yl)acetyl]oxolane-2,4-dione (PubChem CID 90750019) has the molecular formula C27H22O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is 5-(2-phenylethyl)-3-[2-(9H-thioxanthen-9-yl)acetyl]oxolane-2,4-dione.
| Compound Name | 5-(2-phenylethyl)-3-[2-(9H-thioxanthen-9-yl)acetyl]oxolane-2,4-dione |
|---|---|
| PubChem CID | 90750019 |
| Molecular Formula | C27H22O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 5-(2-phenylethyl)-3-[2-(9H-thioxanthen-9-yl)acetyl]oxolane-2,4-dione |
| SMILES | O=C(CC1c2ccccc2Sc2ccccc21)C1C(=O)OC(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C27H22O4S/c28-21(25-26(29)22(31-27(25)30)15-14-17-8-2-1-3-9-17)16-20-18-10-4-6-12-23(18)32-24-13-7-5-11-19(20)24/h1-13,20,22,25H,14-16H2 |
| InChIKey | HWXAXKLOYLEAMJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|