C21H30O11 — CID 54752109
(2S,3S,4S,5R,6S)-6-(2,3-dihydroxy-5-octoxycarbonylphenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 54752109) has the molecular formula C21H30O11 and a molecular weight of 458.46 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-6-(2,3-dihydroxy-5-octoxycarbonylphenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-6-(2,3-dihydroxy-5-octoxycarbonylphenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 54752109 |
| Molecular Formula | C21H30O11 |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-(2,3-dihydroxy-5-octoxycarbonylphenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CCCCCCCCOC(=O)c1cc(O)c(O)c(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C21H30O11/c1-2-3-4-5-6-7-8-30-20(29)11-9-12(22)14(23)13(10-11)31-21-17(26)15(24)16(25)18(32-21)19(27)28/h9-10,15-18,21-26H,2-8H2,1H3,(H,27,28)/t15-,16-,17+,18-,21+/m0/s1 |
| InChIKey | JDXIURUWTMFBFX-HUTLKBDOSA-N |
| XLogP | 0.89 |
| TPSA | 183.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|