C15H23NO6 — CID 54753198
[(1S,2R,6R)-2,3-bis(acetyloxymethyl)-6-aminocyclohex-3-en-1-yl]methyl acetate (PubChem CID 54753198) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is [(1S,2R,6R)-2,3-bis(acetyloxymethyl)-6-aminocyclohex-3-en-1-yl]methyl acetate.
| Compound Name | [(1S,2R,6R)-2,3-bis(acetyloxymethyl)-6-aminocyclohex-3-en-1-yl]methyl acetate |
|---|---|
| PubChem CID | 54753198 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | [(1S,2R,6R)-2,3-bis(acetyloxymethyl)-6-aminocyclohex-3-en-1-yl]methyl acetate |
| SMILES | CC(=O)OCC1=CC[C@@H](N)[C@@H](COC(C)=O)[C@H]1COC(C)=O |
| InChI | InChI=1S/C15H23NO6/c1-9(17)20-6-12-4-5-15(16)14(8-22-11(3)19)13(12)7-21-10(2)18/h4,13-15H,5-8,16H2,1-3H3/t13-,14-,15+/m0/s1 |
| InChIKey | RTSGFLFIKDDQLH-SOUVJXGZSA-N |
| XLogP | 0.57 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|