C24H19Cl3N4 — CID 5475348
2-[(E)-[(2E)-1,5,5-tris(4-chlorophenyl)penta-2,4-dienylidene]amino]guanidine (PubChem CID 5475348) has the molecular formula C24H19Cl3N4 and a molecular weight of 469.80 g/mol. Its IUPAC name is 2-[(E)-[(2E)-1,5,5-tris(4-chlorophenyl)penta-2,4-dienylidene]amino]guanidine.
| Compound Name | 2-[(E)-[(2E)-1,5,5-tris(4-chlorophenyl)penta-2,4-dienylidene]amino]guanidine |
|---|---|
| PubChem CID | 5475348 |
| Molecular Formula | C24H19Cl3N4 |
| Molecular Weight | 469.80 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 2-[(E)-[(2E)-1,5,5-tris(4-chlorophenyl)penta-2,4-dienylidene]amino]guanidine |
| SMILES | NC(N)=N/N=C(\C=C\C=C(c1ccc(Cl)cc1)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H19Cl3N4/c25-19-10-4-16(5-11-19)22(17-6-12-20(26)13-7-17)2-1-3-23(30-31-24(28)29)18-8-14-21(27)15-9-18/h1-15H,(H4,28,29,31)/b3-1+,30-23+ |
| InChIKey | CGERTGROJICAEY-HHIQNHBISA-N |
| XLogP | 6.31 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.80 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|