C24H31NO2S — CID 54754253
(4S,4aR,10bR)-3-(4-methylphenyl)sulfonyl-4-(2-methylpropyl)-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline (PubChem CID 54754253) has the molecular formula C24H31NO2S and a molecular weight of 397.58 g/mol. Its IUPAC name is (4S,4aR,10bR)-3-(4-methylphenyl)sulfonyl-4-(2-methylpropyl)-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline.
| Compound Name | (4S,4aR,10bR)-3-(4-methylphenyl)sulfonyl-4-(2-methylpropyl)-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline |
|---|---|
| PubChem CID | 54754253 |
| Molecular Formula | C24H31NO2S |
| Molecular Weight | 397.58 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | (4S,4aR,10bR)-3-(4-methylphenyl)sulfonyl-4-(2-methylpropyl)-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@H]3c4ccccc4CC[C@H]3[C@@H]2CC(C)C)cc1 |
| InChI | InChI=1S/C24H31NO2S/c1-17(2)16-24-23-13-10-19-6-4-5-7-21(19)22(23)14-15-25(24)28(26,27)20-11-8-18(3)9-12-20/h4-9,11-12,17,22-24H,10,13-16H2,1-3H3/t22-,23+,24-/m0/s1 |
| InChIKey | PNMKZTIBKAUVBR-VXNXHJTFSA-N |
| XLogP | 5.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |