C27H28BrNO2S — CID 54751842
(4R,4aS,10bR)-4-(4-bromophenyl)-9-methyl-3-(4-methylphenyl)sulfonyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline (PubChem CID 54751842) has the molecular formula C27H28BrNO2S and a molecular weight of 510.50 g/mol. Its IUPAC name is (4R,4aS,10bR)-4-(4-bromophenyl)-9-methyl-3-(4-methylphenyl)sulfonyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline.
| Compound Name | (4R,4aS,10bR)-4-(4-bromophenyl)-9-methyl-3-(4-methylphenyl)sulfonyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline |
|---|---|
| PubChem CID | 54751842 |
| Molecular Formula | C27H28BrNO2S |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | (4R,4aS,10bR)-4-(4-bromophenyl)-9-methyl-3-(4-methylphenyl)sulfonyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isoquinoline |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@H]3c4cc(C)ccc4CC[C@@H]3[C@@H]2c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C27H28BrNO2S/c1-18-4-12-23(13-5-18)32(30,31)29-16-15-24-25(27(29)21-7-10-22(28)11-8-21)14-9-20-6-3-19(2)17-26(20)24/h3-8,10-13,17,24-25,27H,9,14-16H2,1-2H3/t24-,25+,27+/m1/s1 |
| InChIKey | VKMXWNXPJLKIRQ-OBDYRVMHSA-N |
| XLogP | 6.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |