C12H18N2O4S2 — CID 175108840
1-(4-methylphenyl)sulfonyl-3-methylsulfonylpyrrolidin-2-amine (PubChem CID 175108840) has the molecular formula C12H18N2O4S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3-methylsulfonylpyrrolidin-2-amine.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3-methylsulfonylpyrrolidin-2-amine |
|---|---|
| PubChem CID | 175108840 |
| Molecular Formula | C12H18N2O4S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3-methylsulfonylpyrrolidin-2-amine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(S(C)(=O)=O)C2N)cc1 |
| InChI | InChI=1S/C12H18N2O4S2/c1-9-3-5-10(6-4-9)20(17,18)14-8-7-11(12(14)13)19(2,15)16/h3-6,11-12H,7-8,13H2,1-2H3 |
| InChIKey | ASIQJKLZQJZFAR-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |