C24H31N5O3S — CID 54760440
methyl 1-[[6-[2-(dimethylamino)-1-imidazol-1-ylbutyl]-1,3-benzothiazol-2-yl]carbamoyl]cyclopentane-1-carboxylate (PubChem CID 54760440) has the molecular formula C24H31N5O3S and a molecular weight of 469.61 g/mol. Its IUPAC name is methyl 1-[[6-[2-(dimethylamino)-1-imidazol-1-ylbutyl]-1,3-benzothiazol-2-yl]carbamoyl]cyclopentane-1-carboxylate.
| Compound Name | methyl 1-[[6-[2-(dimethylamino)-1-imidazol-1-ylbutyl]-1,3-benzothiazol-2-yl]carbamoyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 54760440 |
| Molecular Formula | C24H31N5O3S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | methyl 1-[[6-[2-(dimethylamino)-1-imidazol-1-ylbutyl]-1,3-benzothiazol-2-yl]carbamoyl]cyclopentane-1-carboxylate |
| SMILES | CCC(C(c1ccc2nc(NC(=O)C3(C(=O)OC)CCCC3)sc2c1)n1ccnc1)N(C)C |
| InChI | InChI=1S/C24H31N5O3S/c1-5-18(28(2)3)20(29-13-12-25-15-29)16-8-9-17-19(14-16)33-23(26-17)27-21(30)24(22(31)32-4)10-6-7-11-24/h8-9,12-15,18,20H,5-7,10-11H2,1-4H3,(H,26,27,30) |
| InChIKey | BWUBKQHQUQRVIY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|