C15H19N3O2S — CID 104596064
N-(6-methoxy-1,3-benzothiazol-2-yl)-2-methylpiperidine-2-carboxamide (PubChem CID 104596064) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-2-methylpiperidine-2-carboxamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-2-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 104596064 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-2-methylpiperidine-2-carboxamide |
| SMILES | COc1ccc2nc(NC(=O)C3(C)CCCCN3)sc2c1 |
| InChI | InChI=1S/C15H19N3O2S/c1-15(7-3-4-8-16-15)13(19)18-14-17-11-6-5-10(20-2)9-12(11)21-14/h5-6,9,16H,3-4,7-8H2,1-2H3,(H,17,18,19) |
| InChIKey | QUOFBPHQKMLTQA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |