C30H26N4O3 — CID 54761729
3-[3-[3-[1-ethyl-6-oxo-5-(quinolin-5-ylamino)pyridazin-3-yl]phenyl]phenyl]propanoic acid (PubChem CID 54761729) has the molecular formula C30H26N4O3 and a molecular weight of 490.56 g/mol. Its IUPAC name is 3-[3-[3-[1-ethyl-6-oxo-5-(quinolin-5-ylamino)pyridazin-3-yl]phenyl]phenyl]propanoic acid.
| Compound Name | 3-[3-[3-[1-ethyl-6-oxo-5-(quinolin-5-ylamino)pyridazin-3-yl]phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 54761729 |
| Molecular Formula | C30H26N4O3 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 3-[3-[3-[1-ethyl-6-oxo-5-(quinolin-5-ylamino)pyridazin-3-yl]phenyl]phenyl]propanoic acid |
| SMILES | CCn1nc(-c2cccc(-c3cccc(CCC(=O)O)c3)c2)cc(Nc2cccc3ncccc23)c1=O |
| InChI | InChI=1S/C30H26N4O3/c1-2-34-30(37)28(32-26-13-5-12-25-24(26)11-6-16-31-25)19-27(33-34)23-10-4-9-22(18-23)21-8-3-7-20(17-21)14-15-29(35)36/h3-13,16-19,32H,2,14-15H2,1H3,(H,35,36) |
| InChIKey | LRODUKPEVKZRGS-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |