C28H23N5O2 — CID 54760472
3-[3-[1-ethyl-5-(isoquinolin-4-ylamino)-6-oxopyridazin-3-yl]phenyl]benzamide (PubChem CID 54760472) has the molecular formula C28H23N5O2 and a molecular weight of 461.53 g/mol. Its IUPAC name is 3-[3-[1-ethyl-5-(isoquinolin-4-ylamino)-6-oxopyridazin-3-yl]phenyl]benzamide.
| Compound Name | 3-[3-[1-ethyl-5-(isoquinolin-4-ylamino)-6-oxopyridazin-3-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 54760472 |
| Molecular Formula | C28H23N5O2 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 3-[3-[1-ethyl-5-(isoquinolin-4-ylamino)-6-oxopyridazin-3-yl]phenyl]benzamide |
| SMILES | CCn1nc(-c2cccc(-c3cccc(C(N)=O)c3)c2)cc(Nc2cncc3ccccc23)c1=O |
| InChI | InChI=1S/C28H23N5O2/c1-2-33-28(35)25(31-26-17-30-16-22-7-3-4-12-23(22)26)15-24(32-33)20-10-5-8-18(13-20)19-9-6-11-21(14-19)27(29)34/h3-17,31H,2H2,1H3,(H2,29,34) |
| InChIKey | BIGFBFMYCUSKIK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |