C24H22N4O4 — CID 11690521
2-phenoxyethyl 1-ethyl-5-(isoquinolin-4-ylamino)-6-oxopyridazine-3-carboxylate (PubChem CID 11690521) has the molecular formula C24H22N4O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is 2-phenoxyethyl 1-ethyl-5-(isoquinolin-4-ylamino)-6-oxopyridazine-3-carboxylate.
| Compound Name | 2-phenoxyethyl 1-ethyl-5-(isoquinolin-4-ylamino)-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 11690521 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 2-phenoxyethyl 1-ethyl-5-(isoquinolin-4-ylamino)-6-oxopyridazine-3-carboxylate |
| SMILES | CCn1nc(C(=O)OCCOc2ccccc2)cc(Nc2cncc3ccccc23)c1=O |
| InChI | InChI=1S/C24H22N4O4/c1-2-28-23(29)20(26-22-16-25-15-17-8-6-7-11-19(17)22)14-21(27-28)24(30)32-13-12-31-18-9-4-3-5-10-18/h3-11,14-16,26H,2,12-13H2,1H3 |
| InChIKey | IFGHWJHKQNJCHW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|