C25H30N2O2S — CID 54762323
N-[(1R,2R)-2-(benzylamino)-3-methyl-1-phenylbutyl]-4-methylbenzenesulfonamide (PubChem CID 54762323) has the molecular formula C25H30N2O2S and a molecular weight of 422.59 g/mol. Its IUPAC name is N-[(1R,2R)-2-(benzylamino)-3-methyl-1-phenylbutyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R,2R)-2-(benzylamino)-3-methyl-1-phenylbutyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 54762323 |
| Molecular Formula | C25H30N2O2S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N-[(1R,2R)-2-(benzylamino)-3-methyl-1-phenylbutyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](c2ccccc2)[C@H](NCc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C25H30N2O2S/c1-19(2)24(26-18-21-10-6-4-7-11-21)25(22-12-8-5-9-13-22)27-30(28,29)23-16-14-20(3)15-17-23/h4-17,19,24-27H,18H2,1-3H3/t24-,25-/m1/s1 |
| InChIKey | YWQPHZRRXOYIFM-JWQCQUIFSA-N |
| XLogP | 4.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |