C21H18O6 — CID 54763532
(7R,8R)-5,7-dihydroxy-2,2-dimethyl-6-oxo-8-phenyl-7,8-dihydropyrano[3,2-g]chromene-10-carbaldehyde (PubChem CID 54763532) has the molecular formula C21H18O6 and a molecular weight of 366.37 g/mol. Its IUPAC name is (7R,8R)-5,7-dihydroxy-2,2-dimethyl-6-oxo-8-phenyl-7,8-dihydropyrano[3,2-g]chromene-10-carbaldehyde.
| Compound Name | (7R,8R)-5,7-dihydroxy-2,2-dimethyl-6-oxo-8-phenyl-7,8-dihydropyrano[3,2-g]chromene-10-carbaldehyde |
|---|---|
| PubChem CID | 54763532 |
| Molecular Formula | C21H18O6 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | (7R,8R)-5,7-dihydroxy-2,2-dimethyl-6-oxo-8-phenyl-7,8-dihydropyrano[3,2-g]chromene-10-carbaldehyde |
| SMILES | CC1(C)C=Cc2c(O)c3c(c(C=O)c2O1)O[C@H](c1ccccc1)[C@@H](O)C3=O |
| InChI | InChI=1S/C21H18O6/c1-21(2)9-8-12-15(23)14-16(24)17(25)18(11-6-4-3-5-7-11)26-20(14)13(10-22)19(12)27-21/h3-10,17-18,23,25H,1-2H3/t17-,18+/m0/s1 |
| InChIKey | AAJFCQJUBNHXEM-ZWKOTPCHSA-N |
| XLogP | 3.07 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|