C9H12O4 — CID 54763779
(1S,2R,6S,7S)-4,9,11-trioxatricyclo[5.5.0.02,6]dodecan-3-one (PubChem CID 54763779) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is (1S,2R,6S,7S)-4,9,11-trioxatricyclo[5.5.0.02,6]dodecan-3-one.
| Compound Name | (1S,2R,6S,7S)-4,9,11-trioxatricyclo[5.5.0.02,6]dodecan-3-one |
|---|---|
| PubChem CID | 54763779 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (1S,2R,6S,7S)-4,9,11-trioxatricyclo[5.5.0.02,6]dodecan-3-one |
| SMILES | O=C1OC[C@H]2[C@H]3COCOC[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C9H12O4/c10-9-8-6-2-12-4-11-1-5(6)7(8)3-13-9/h5-8H,1-4H2/t5-,6-,7-,8+/m0/s1 |
| InChIKey | BOKPTBKDRHXQLH-DKXJUACHSA-N |
| XLogP | 0.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |