C10H12O6 — CID 91732284
8,10-dimethoxy-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5-dione (PubChem CID 91732284) has the molecular formula C10H12O6 and a molecular weight of 228.20 g/mol. Its IUPAC name is 8,10-dimethoxy-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5-dione.
| Compound Name | 8,10-dimethoxy-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 91732284 |
| Molecular Formula | C10H12O6 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 8,10-dimethoxy-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5-dione |
| SMILES | COC1OC(OC)C2C3C(=O)OC(=O)C3C12 |
| InChI | InChI=1S/C10H12O6/c1-13-9-5-3-4(8(12)15-7(3)11)6(5)10(14-2)16-9/h3-6,9-10H,1-2H3 |
| InChIKey | FKYNJTWEBVGFMG-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|