C8H10O3 — CID 123897879
4,9-dioxatricyclo[5.3.0.02,6]decan-3-one (PubChem CID 123897879) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is 4,9-dioxatricyclo[5.3.0.02,6]decan-3-one.
| Compound Name | 4,9-dioxatricyclo[5.3.0.02,6]decan-3-one |
|---|---|
| PubChem CID | 123897879 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 4,9-dioxatricyclo[5.3.0.02,6]decan-3-one |
| SMILES | O=C1OCC2C3COCC3C12 |
| InChI | InChI=1S/C8H10O3/c9-8-7-5-2-10-1-4(5)6(7)3-11-8/h4-7H,1-3H2 |
| InChIKey | DKCCLFDSMOHSDW-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |