C29H55NO3 — CID 54764640
decyl 2-butyl-1-decyl-5-oxopyrrolidine-3-carboxylate (PubChem CID 54764640) has the molecular formula C29H55NO3 and a molecular weight of 465.76 g/mol. Its IUPAC name is decyl 2-butyl-1-decyl-5-oxopyrrolidine-3-carboxylate.
| Compound Name | decyl 2-butyl-1-decyl-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 54764640 |
| Molecular Formula | C29H55NO3 |
| Molecular Weight | 465.76 g/mol |
| Exact Mass | 465.42 |
| IUPAC Name | decyl 2-butyl-1-decyl-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCCCCCCCCCOC(=O)C1CC(=O)N(CCCCCCCCCC)C1CCCC |
| InChI | InChI=1S/C29H55NO3/c1-4-7-10-12-14-16-18-20-23-30-27(22-9-6-3)26(25-28(30)31)29(32)33-24-21-19-17-15-13-11-8-5-2/h26-27H,4-25H2,1-3H3 |
| InChIKey | FMCHGIJGAKOUFW-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.76 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|