C24H19ClFN3O3 — CID 54765612
1-(2-chlorophenyl)ethyl N-[5-[4-(6-fluoro-3-pyridinyl)phenyl]-3-methyl-1,2-oxazol-4-yl]carbamate (PubChem CID 54765612) has the molecular formula C24H19ClFN3O3 and a molecular weight of 451.89 g/mol. Its IUPAC name is 1-(2-chlorophenyl)ethyl N-[5-[4-(6-fluoro-3-pyridinyl)phenyl]-3-methyl-1,2-oxazol-4-yl]carbamate.
| Compound Name | 1-(2-chlorophenyl)ethyl N-[5-[4-(6-fluoro-3-pyridinyl)phenyl]-3-methyl-1,2-oxazol-4-yl]carbamate |
|---|---|
| PubChem CID | 54765612 |
| Molecular Formula | C24H19ClFN3O3 |
| Molecular Weight | 451.89 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 1-(2-chlorophenyl)ethyl N-[5-[4-(6-fluoro-3-pyridinyl)phenyl]-3-methyl-1,2-oxazol-4-yl]carbamate |
| SMILES | Cc1noc(-c2ccc(-c3ccc(F)nc3)cc2)c1NC(=O)OC(C)c1ccccc1Cl |
| InChI | InChI=1S/C24H19ClFN3O3/c1-14-22(28-24(30)31-15(2)19-5-3-4-6-20(19)25)23(32-29-14)17-9-7-16(8-10-17)18-11-12-21(26)27-13-18/h3-13,15H,1-2H3,(H,28,30) |
| InChIKey | VBSSISMBXIPLMJ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.89 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|