C24H23F2N3O6S — CID 54767138
N-[(3,4-difluorophenyl)methyl]-3-[3-methoxy-4-[(2-methyl-4-nitrophenyl)sulfamoyl]phenyl]propanamide (PubChem CID 54767138) has the molecular formula C24H23F2N3O6S and a molecular weight of 519.53 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-3-[3-methoxy-4-[(2-methyl-4-nitrophenyl)sulfamoyl]phenyl]propanamide.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-3-[3-methoxy-4-[(2-methyl-4-nitrophenyl)sulfamoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 54767138 |
| Molecular Formula | C24H23F2N3O6S |
| Molecular Weight | 519.53 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-3-[3-methoxy-4-[(2-methyl-4-nitrophenyl)sulfamoyl]phenyl]propanamide |
| SMILES | COc1cc(CCC(=O)NCc2ccc(F)c(F)c2)ccc1S(=O)(=O)Nc1ccc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C24H23F2N3O6S/c1-15-11-18(29(31)32)6-8-21(15)28-36(33,34)23-9-4-16(13-22(23)35-2)5-10-24(30)27-14-17-3-7-19(25)20(26)12-17/h3-4,6-9,11-13,28H,5,10,14H2,1-2H3,(H,27,30) |
| InChIKey | QMOHLRABNUKYKH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|