C22H23N3O7S — CID 54766832
N-(furan-2-ylmethyl)-3-[3-methoxy-4-[(2-methyl-4-nitrophenyl)sulfamoyl]phenyl]propanamide (PubChem CID 54766832) has the molecular formula C22H23N3O7S and a molecular weight of 473.51 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-[3-methoxy-4-[(2-methyl-4-nitrophenyl)sulfamoyl]phenyl]propanamide.
| Compound Name | N-(furan-2-ylmethyl)-3-[3-methoxy-4-[(2-methyl-4-nitrophenyl)sulfamoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 54766832 |
| Molecular Formula | C22H23N3O7S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-[3-methoxy-4-[(2-methyl-4-nitrophenyl)sulfamoyl]phenyl]propanamide |
| SMILES | COc1cc(CCC(=O)NCc2ccco2)ccc1S(=O)(=O)Nc1ccc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C22H23N3O7S/c1-15-12-17(25(27)28)7-8-19(15)24-33(29,30)21-9-5-16(13-20(21)31-2)6-10-22(26)23-14-18-4-3-11-32-18/h3-5,7-9,11-13,24H,6,10,14H2,1-2H3,(H,23,26) |
| InChIKey | MZZZLYGXYDBKHD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 140.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|