C25H27N5O3 — CID 54767644
1-benzoyl-N-butyl-3-[(4-methylbenzoyl)amino]-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide (PubChem CID 54767644) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is 1-benzoyl-N-butyl-3-[(4-methylbenzoyl)amino]-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide.
| Compound Name | 1-benzoyl-N-butyl-3-[(4-methylbenzoyl)amino]-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 54767644 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 1-benzoyl-N-butyl-3-[(4-methylbenzoyl)amino]-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide |
| SMILES | CCCCNC(=O)N1Cc2c(NC(=O)c3ccc(C)cc3)nn(C(=O)c3ccccc3)c2C1 |
| InChI | InChI=1S/C25H27N5O3/c1-3-4-14-26-25(33)29-15-20-21(16-29)30(24(32)19-8-6-5-7-9-19)28-22(20)27-23(31)18-12-10-17(2)11-13-18/h5-13H,3-4,14-16H2,1-2H3,(H,26,33)(H,27,28,31) |
| InChIKey | ITAAQZMOVIMBIC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|