C23H27N5O5S — CID 141232146
ethyl 5-(butylcarbamoyl)-3-(naphthalen-1-ylsulfonylamino)-4,6-dihydropyrrolo[3,4-d]pyrazole-1-carboxylate (PubChem CID 141232146) has the molecular formula C23H27N5O5S and a molecular weight of 485.57 g/mol. Its IUPAC name is ethyl 5-(butylcarbamoyl)-3-(naphthalen-1-ylsulfonylamino)-4,6-dihydropyrrolo[3,4-d]pyrazole-1-carboxylate.
| Compound Name | ethyl 5-(butylcarbamoyl)-3-(naphthalen-1-ylsulfonylamino)-4,6-dihydropyrrolo[3,4-d]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 141232146 |
| Molecular Formula | C23H27N5O5S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | ethyl 5-(butylcarbamoyl)-3-(naphthalen-1-ylsulfonylamino)-4,6-dihydropyrrolo[3,4-d]pyrazole-1-carboxylate |
| SMILES | CCCCNC(=O)N1Cc2c(NS(=O)(=O)c3cccc4ccccc34)nn(C(=O)OCC)c2C1 |
| InChI | InChI=1S/C23H27N5O5S/c1-3-5-13-24-22(29)27-14-18-19(15-27)28(23(30)33-4-2)25-21(18)26-34(31,32)20-12-8-10-16-9-6-7-11-17(16)20/h6-12H,3-5,13-15H2,1-2H3,(H,24,29)(H,25,26) |
| InChIKey | YLBINQNHMNLQLO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|