C16H24N4O3 — CID 6734798
ethyl 4-(2-anilinoethylcarbamoyl)piperazine-1-carboxylate (PubChem CID 6734798) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is ethyl 4-(2-anilinoethylcarbamoyl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(2-anilinoethylcarbamoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 6734798 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | ethyl 4-(2-anilinoethylcarbamoyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)NCCNc2ccccc2)CC1 |
| InChI | InChI=1S/C16H24N4O3/c1-2-23-16(22)20-12-10-19(11-13-20)15(21)18-9-8-17-14-6-4-3-5-7-14/h3-7,17H,2,8-13H2,1H3,(H,18,21) |
| InChIKey | ASAPGKBQTXWWBO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|