C23H21NO6 — CID 54768417
(11S,15R)-13,13,27-trimethyl-5,7,12,14,21,23-hexaoxa-27-azaheptacyclo[14.11.0.02,10.04,8.011,15.017,25.020,24]heptacosa-1(16),2,4(8),9,17(25),18,20(24)-heptaene (PubChem CID 54768417) has the molecular formula C23H21NO6 and a molecular weight of 407.42 g/mol. Its IUPAC name is (11S,15R)-13,13,27-trimethyl-5,7,12,14,21,23-hexaoxa-27-azaheptacyclo[14.11.0.02,10.04,8.011,15.017,25.020,24]heptacosa-1(16),2,4(8),9,17(25),18,20(24)-heptaene.
| Compound Name | (11S,15R)-13,13,27-trimethyl-5,7,12,14,21,23-hexaoxa-27-azaheptacyclo[14.11.0.02,10.04,8.011,15.017,25.020,24]heptacosa-1(16),2,4(8),9,17(25),18,20(24)-heptaene |
|---|---|
| PubChem CID | 54768417 |
| Molecular Formula | C23H21NO6 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (11S,15R)-13,13,27-trimethyl-5,7,12,14,21,23-hexaoxa-27-azaheptacyclo[14.11.0.02,10.04,8.011,15.017,25.020,24]heptacosa-1(16),2,4(8),9,17(25),18,20(24)-heptaene |
| SMILES | CN1Cc2c(ccc3c2OCO3)C2=C1c1cc3c(cc1[C@@H]1OC(C)(C)O[C@H]21)OCO3 |
| InChI | InChI=1S/C23H21NO6/c1-23(2)29-21-13-7-17-16(26-9-27-17)6-12(13)19-18(22(21)30-23)11-4-5-15-20(28-10-25-15)14(11)8-24(19)3/h4-7,21-22H,8-10H2,1-3H3/t21-,22+/m0/s1 |
| InChIKey | JYMKCOPQNMXUDS-FCHUYYIVSA-N |
| XLogP | 3.66 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|