About 6-amino-5-(1,3-benzothiazol-2-yl)-4-thiophen-2-ylpyridine-3-carbonitrile
6-amino-5-(1,3-benzothiazol-2-yl)-4-thiophen-2-ylpyridine-3-carbonitrile (PubChem CID 54768671) has the molecular formula C17H10N4S2
and a molecular weight of 334.43 g/mol. Its IUPAC name is 6-amino-5-(1,3-benzothiazol-2-yl)-4-thiophen-2-ylpyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-amino-5-(1,3-benzothiazol-2-yl)-4-thiophen-2-ylpyridine-3-carbonitrile |
| PubChem CID | 54768671 |
| Molecular Formula | C17H10N4S2 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 6-amino-5-(1,3-benzothiazol-2-yl)-4-thiophen-2-ylpyridine-3-carbonitrile |
| SMILES | N#Cc1cnc(N)c(-c2nc3ccccc3s2)c1-c1cccs1 |
| InChI | InChI=1S/C17H10N4S2/c18-8-10-9-20-16(19)15(14(10)13-6-3-7-22-13)17-21-11-4-1-2-5-12(11)23-17/h1-7,9H,(H2,19,20) |
| InChIKey | ZXYRCFNTJZWMBO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-amino-5-(1,3-benzothiazol-2-yl)-4-thiophen-2-ylpyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-(1,3-benzothiazol-2-yl)-4-thiophen-2-ylpyridine-3-carbonitrile?
The IUPAC name of 6-amino-5-(1,3-benzothiazol-2-yl)-4-thiophen-2-ylpyridine-3-carbonitrile (CID 54768671) is 6-amino-5-(1,3-benzothiazol-2-yl)-4-thiophen-2-ylpyridine-3-carbonitrile.
What is the SMILES notation for 6-amino-5-(1,3-benzothiazol-2-yl)-4-thiophen-2-ylpyridine-3-carbonitrile?
The canonical SMILES for 6-amino-5-(1,3-benzothiazol-2-yl)-4-thiophen-2-ylpyridine-3-carbonitrile is N#Cc1cnc(N)c(-c2nc3ccccc3s2)c1-c1cccs1.
What is the InChIKey of 6-amino-5-(1,3-benzothiazol-2-yl)-4-thiophen-2-ylpyridine-3-carbonitrile?
The InChIKey is ZXYRCFNTJZWMBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10N4S2/c18-8-10-9-20-16(19)15(14(10)13-6-3-7-22-13)17-21-11-4-1-2-5-12(11)23-17/h1-7,9H,(H2,19,20).
What are the key properties of 6-amino-5-(1,3-benzothiazol-2-yl)-4-thiophen-2-ylpyridine-3-carbonitrile?
6-amino-5-(1,3-benzothiazol-2-yl)-4-thiophen-2-ylpyridine-3-carbonitrile has a molecular weight of 334.43 g/mol, XLogP of 4.54, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-(1,3-benzothiazol-2-yl)-4-thiophen-2-ylpyridine-3-carbonitrile is sourced from PubChem (CID 54768671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).