C20H28O5 — CID 54769790
methyl 5-[[8-(3-methylbutyl)-2-oxo-3,4-dihydrochromen-7-yl]oxy]pentanoate (PubChem CID 54769790) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is methyl 5-[[8-(3-methylbutyl)-2-oxo-3,4-dihydrochromen-7-yl]oxy]pentanoate.
| Compound Name | methyl 5-[[8-(3-methylbutyl)-2-oxo-3,4-dihydrochromen-7-yl]oxy]pentanoate |
|---|---|
| PubChem CID | 54769790 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | methyl 5-[[8-(3-methylbutyl)-2-oxo-3,4-dihydrochromen-7-yl]oxy]pentanoate |
| SMILES | COC(=O)CCCCOc1ccc2c(c1CCC(C)C)OC(=O)CC2 |
| InChI | InChI=1S/C20H28O5/c1-14(2)7-10-16-17(24-13-5-4-6-18(21)23-3)11-8-15-9-12-19(22)25-20(15)16/h8,11,14H,4-7,9-10,12-13H2,1-3H3 |
| InChIKey | LAXUNJWZGBPIQX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|