C33H42N6O6 — CID 54769793
N-(diaminomethylidene)-3-[(4-ethylbenzoyl)amino]-4-[2-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]ethoxy]benzamide (PubChem CID 54769793) has the molecular formula C33H42N6O6 and a molecular weight of 618.74 g/mol. Its IUPAC name is N-(diaminomethylidene)-3-[(4-ethylbenzoyl)amino]-4-[2-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]ethoxy]benzamide.
| Compound Name | N-(diaminomethylidene)-3-[(4-ethylbenzoyl)amino]-4-[2-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]ethoxy]benzamide |
|---|---|
| PubChem CID | 54769793 |
| Molecular Formula | C33H42N6O6 |
| Molecular Weight | 618.74 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | N-(diaminomethylidene)-3-[(4-ethylbenzoyl)amino]-4-[2-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]ethoxy]benzamide |
| SMILES | CCc1ccc(C(=O)Nc2cc(C(=O)N=C(N)N)ccc2OCCN2CCN(Cc3ccc(OC)c(OC)c3OC)CC2)cc1 |
| InChI | InChI=1S/C33H42N6O6/c1-5-22-6-8-23(9-7-22)31(40)36-26-20-24(32(41)37-33(34)35)10-12-27(26)45-19-18-38-14-16-39(17-15-38)21-25-11-13-28(42-2)30(44-4)29(25)43-3/h6-13,20H,5,14-19,21H2,1-4H3,(H,36,40)(H4,34,35,37,41) |
| InChIKey | NTWNSVNMUKHPBM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 153.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.74 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|