C32H40N6O6 — CID 54770225
3-benzamido-N-(diaminomethylidene)-4-[3-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]propoxy]benzamide (PubChem CID 54770225) has the molecular formula C32H40N6O6 and a molecular weight of 604.71 g/mol. Its IUPAC name is 3-benzamido-N-(diaminomethylidene)-4-[3-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]propoxy]benzamide.
| Compound Name | 3-benzamido-N-(diaminomethylidene)-4-[3-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]propoxy]benzamide |
|---|---|
| PubChem CID | 54770225 |
| Molecular Formula | C32H40N6O6 |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | 3-benzamido-N-(diaminomethylidene)-4-[3-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]propoxy]benzamide |
| SMILES | COc1ccc(CN2CCN(CCCOc3ccc(C(=O)N=C(N)N)cc3NC(=O)c3ccccc3)CC2)c(OC)c1OC |
| InChI | InChI=1S/C32H40N6O6/c1-41-27-13-11-24(28(42-2)29(27)43-3)21-38-17-15-37(16-18-38)14-7-19-44-26-12-10-23(31(40)36-32(33)34)20-25(26)35-30(39)22-8-5-4-6-9-22/h4-6,8-13,20H,7,14-19,21H2,1-3H3,(H,35,39)(H4,33,34,36,40) |
| InChIKey | XPQVSFJUUZJCDR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 153.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|