C20H20N4O — CID 54771019
(3E)-6-amino-3-[[4-(dimethylamino)phenyl]methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one (PubChem CID 54771019) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is (3E)-6-amino-3-[[4-(dimethylamino)phenyl]methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one.
| Compound Name | (3E)-6-amino-3-[[4-(dimethylamino)phenyl]methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one |
|---|---|
| PubChem CID | 54771019 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (3E)-6-amino-3-[[4-(dimethylamino)phenyl]methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one |
| SMILES | CN(C)c1ccc(/C=C2\CCn3c2nc2cc(N)ccc2c3=O)cc1 |
| InChI | InChI=1S/C20H20N4O/c1-23(2)16-6-3-13(4-7-16)11-14-9-10-24-19(14)22-18-12-15(21)5-8-17(18)20(24)25/h3-8,11-12H,9-10,21H2,1-2H3/b14-11+ |
| InChIKey | RPJPRDIFXNUTBL-SDNWHVSQSA-N |
| XLogP | 2.99 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|