C24H25ClO6 — CID 54771878
2-[1-(4-chlorophenyl)-3-(4-methoxyphenyl)-3-oxopropyl]-2-hydroperoxy-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 54771878) has the molecular formula C24H25ClO6 and a molecular weight of 444.91 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)-3-(4-methoxyphenyl)-3-oxopropyl]-2-hydroperoxy-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[1-(4-chlorophenyl)-3-(4-methoxyphenyl)-3-oxopropyl]-2-hydroperoxy-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 54771878 |
| Molecular Formula | C24H25ClO6 |
| Molecular Weight | 444.91 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 2-[1-(4-chlorophenyl)-3-(4-methoxyphenyl)-3-oxopropyl]-2-hydroperoxy-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | COc1ccc(C(=O)CC(c2ccc(Cl)cc2)C2(OO)C(=O)CC(C)(C)CC2=O)cc1 |
| InChI | InChI=1S/C24H25ClO6/c1-23(2)13-21(27)24(31-29,22(28)14-23)19(15-4-8-17(25)9-5-15)12-20(26)16-6-10-18(30-3)11-7-16/h4-11,19,29H,12-14H2,1-3H3 |
| InChIKey | DEBLNKCXIGYMRZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.91 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|