C39H45N3O6 — CID 54772189
5-hydroxy-8-[(1R)-1-hydroxy-2-[2-[4-[3-[4-hydroxy-3-(1-methyl-4-phenylpiperidin-4-yl)phenyl]propoxy]phenyl]ethylamino]ethyl]-4H-1,4-benzoxazin-3-one (PubChem CID 54772189) has the molecular formula C39H45N3O6 and a molecular weight of 651.80 g/mol. Its IUPAC name is 5-hydroxy-8-[(1R)-1-hydroxy-2-[2-[4-[3-[4-hydroxy-3-(1-methyl-4-phenylpiperidin-4-yl)phenyl]propoxy]phenyl]ethylamino]ethyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 5-hydroxy-8-[(1R)-1-hydroxy-2-[2-[4-[3-[4-hydroxy-3-(1-methyl-4-phenylpiperidin-4-yl)phenyl]propoxy]phenyl]ethylamino]ethyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 54772189 |
| Molecular Formula | C39H45N3O6 |
| Molecular Weight | 651.80 g/mol |
| Exact Mass | 651.33 |
| IUPAC Name | 5-hydroxy-8-[(1R)-1-hydroxy-2-[2-[4-[3-[4-hydroxy-3-(1-methyl-4-phenylpiperidin-4-yl)phenyl]propoxy]phenyl]ethylamino]ethyl]-4H-1,4-benzoxazin-3-one |
| SMILES | CN1CCC(c2ccccc2)(c2cc(CCCOc3ccc(CCNC[C@H](O)c4ccc(O)c5c4OCC(=O)N5)cc3)ccc2O)CC1 |
| InChI | InChI=1S/C39H45N3O6/c1-42-21-18-39(19-22-42,29-7-3-2-4-8-29)32-24-28(11-15-33(32)43)6-5-23-47-30-12-9-27(10-13-30)17-20-40-25-35(45)31-14-16-34(44)37-38(31)48-26-36(46)41-37/h2-4,7-16,24,35,40,43-45H,5-6,17-23,25-26H2,1H3,(H,41,46)/t35-/m0/s1 |
| InChIKey | PTKKUORDQMHZEO-DHUJRADRSA-N |
| XLogP | 5.32 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.80 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|