C45H57N3O5Si — CID 123273634
5-[1-[tert-butyl(dimethyl)silyl]oxy-2-[[4-[3-[4-hydroxy-3-(1-methyl-4-phenylpiperidin-4-yl)phenyl]propoxy]phenyl]methylamino]ethyl]-8-hydroxy-1H-quinolin-2-one (PubChem CID 123273634) has the molecular formula C45H57N3O5Si and a molecular weight of 748.05 g/mol. Its IUPAC name is 5-[1-[tert-butyl(dimethyl)silyl]oxy-2-[[4-[3-[4-hydroxy-3-(1-methyl-4-phenylpiperidin-4-yl)phenyl]propoxy]phenyl]methylamino]ethyl]-8-hydroxy-1H-quinolin-2-one.
| Compound Name | 5-[1-[tert-butyl(dimethyl)silyl]oxy-2-[[4-[3-[4-hydroxy-3-(1-methyl-4-phenylpiperidin-4-yl)phenyl]propoxy]phenyl]methylamino]ethyl]-8-hydroxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 123273634 |
| Molecular Formula | C45H57N3O5Si |
| Molecular Weight | 748.05 g/mol |
| Exact Mass | 747.41 |
| IUPAC Name | 5-[1-[tert-butyl(dimethyl)silyl]oxy-2-[[4-[3-[4-hydroxy-3-(1-methyl-4-phenylpiperidin-4-yl)phenyl]propoxy]phenyl]methylamino]ethyl]-8-hydroxy-1H-quinolin-2-one |
| SMILES | CN1CCC(c2ccccc2)(c2cc(CCCOc3ccc(CNCC(O[Si](C)(C)C(C)(C)C)c4ccc(O)c5[nH]c(=O)ccc45)cc3)ccc2O)CC1 |
| InChI | InChI=1S/C45H57N3O5Si/c1-44(2,3)54(5,6)53-41(36-19-22-40(50)43-37(36)20-23-42(51)47-43)31-46-30-33-14-17-35(18-15-33)52-28-10-11-32-16-21-39(49)38(29-32)45(24-26-48(4)27-25-45)34-12-8-7-9-13-34/h7-9,12-23,29,41,46,49-50H,10-11,24-28,30-31H2,1-6H3,(H,47,51) |
| InChIKey | NJDTVNGNJTYVCY-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 107.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.05 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|