C23H37N3O3Si — CID 145136094
5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-(piperidin-4-ylmethylamino)ethyl]-8-hydroxy-1H-quinolin-2-one (PubChem CID 145136094) has the molecular formula C23H37N3O3Si and a molecular weight of 431.65 g/mol. Its IUPAC name is 5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-(piperidin-4-ylmethylamino)ethyl]-8-hydroxy-1H-quinolin-2-one.
| Compound Name | 5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-(piperidin-4-ylmethylamino)ethyl]-8-hydroxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 145136094 |
| Molecular Formula | C23H37N3O3Si |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-(piperidin-4-ylmethylamino)ethyl]-8-hydroxy-1H-quinolin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CNCC1CCNCC1)c1ccc(O)c2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C23H37N3O3Si/c1-23(2,3)30(4,5)29-20(15-25-14-16-10-12-24-13-11-16)17-6-8-19(27)22-18(17)7-9-21(28)26-22/h6-9,16,20,24-25,27H,10-15H2,1-5H3,(H,26,28)/t20-/m0/s1 |
| InChIKey | PJOGRKXIZNYOBP-FQEVSTJZSA-N |
| XLogP | 3.89 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|