C25H33NO4S — CID 54783511
methyl 2-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 54783511) has the molecular formula C25H33NO4S and a molecular weight of 443.61 g/mol. Its IUPAC name is methyl 2-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 54783511 |
| Molecular Formula | C25H33NO4S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | methyl 2-[[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C(C)(C)CCCOc2cc(C)ccc2C)sc2c1CCCC2 |
| InChI | InChI=1S/C25H33NO4S/c1-16-11-12-17(2)19(15-16)30-14-8-13-25(3,4)24(28)26-22-21(23(27)29-5)18-9-6-7-10-20(18)31-22/h11-12,15H,6-10,13-14H2,1-5H3,(H,26,28) |
| InChIKey | ISSBNFOKISEBGS-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|