C53H58N6O5 — CID 5479483
(2R,6R)-2,6-dibenzyl-4-hydroxy-N,N'-bis[(1S,2S)-2-(isoquinoline-3-carbonylamino)cyclohexyl]heptanediamide (PubChem CID 5479483) has the molecular formula C53H58N6O5 and a molecular weight of 859.08 g/mol. Its IUPAC name is (2R,6R)-2,6-dibenzyl-4-hydroxy-N,N'-bis[(1S,2S)-2-(isoquinoline-3-carbonylamino)cyclohexyl]heptanediamide.
| Compound Name | (2R,6R)-2,6-dibenzyl-4-hydroxy-N,N'-bis[(1S,2S)-2-(isoquinoline-3-carbonylamino)cyclohexyl]heptanediamide |
|---|---|
| PubChem CID | 5479483 |
| Molecular Formula | C53H58N6O5 |
| Molecular Weight | 859.08 g/mol |
| Exact Mass | 858.45 |
| IUPAC Name | (2R,6R)-2,6-dibenzyl-4-hydroxy-N,N'-bis[(1S,2S)-2-(isoquinoline-3-carbonylamino)cyclohexyl]heptanediamide |
| SMILES | O=C(N[C@H]1CCCC[C@@H]1NC(=O)C(Cc1ccccc1)CC(O)C[C@@H](Cc1ccccc1)C(=O)N[C@H]1CCCC[C@@H]1NC(=O)c1cc2ccccc2cn1)c1cc2ccccc2cn1 |
| InChI | InChI=1S/C53H58N6O5/c60-43(29-41(27-35-15-3-1-4-16-35)50(61)56-44-23-11-13-25-46(44)58-52(63)48-31-37-19-7-9-21-39(37)33-54-48)30-42(28-36-17-5-2-6-18-36)51(62)57-45-24-12-14-26-47(45)59-53(64)49-32-38-20-8-10-22-40(38)34-55-49/h1-10,15-22,31-34,41-47,60H,11-14,23-30H2,(H,56,61)(H,57,62)(H,58,63)(H,59,64)/t41-,42?,43?,44+,45+,46+,47+/m1/s1 |
| InChIKey | OFDHFSOXKZFXTL-KSALMFMCSA-N |
| XLogP | 7.66 |
| TPSA | 162.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.08 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |