C13H22N2O — CID 54805794
N'-(4-ethoxyphenyl)-N-propylethane-1,2-diamine (PubChem CID 54805794) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is N'-(4-ethoxyphenyl)-N-propylethane-1,2-diamine.
| Compound Name | N'-(4-ethoxyphenyl)-N-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 54805794 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N'-(4-ethoxyphenyl)-N-propylethane-1,2-diamine |
| SMILES | CCCNCCNc1ccc(OCC)cc1 |
| InChI | InChI=1S/C13H22N2O/c1-3-9-14-10-11-15-12-5-7-13(8-6-12)16-4-2/h5-8,14-15H,3-4,9-11H2,1-2H3 |
| InChIKey | NMAYZPASFYRUGG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|