C21H12N4O3 — CID 5480816
N-(12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-13-yl)formamide (PubChem CID 5480816) has the molecular formula C21H12N4O3 and a molecular weight of 368.35 g/mol. Its IUPAC name is N-(12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-13-yl)formamide.
| Compound Name | N-(12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-13-yl)formamide |
|---|---|
| PubChem CID | 5480816 |
| Molecular Formula | C21H12N4O3 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N-(12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-13-yl)formamide |
| SMILES | O=CNN1C(=O)c2c(c3c4ccccc4[nH]c3c3[nH]c4ccccc4c23)C1=O |
| InChI | InChI=1S/C21H12N4O3/c26-9-22-25-20(27)16-14-10-5-1-3-7-12(10)23-18(14)19-15(17(16)21(25)28)11-6-2-4-8-13(11)24-19/h1-9,23-24H,(H,22,26) |
| InChIKey | WYNVKLTYKHMBHD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|