C28H23N3O4 — CID 142254258
cyclopentene;ethyl 12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-13-carboxylate (PubChem CID 142254258) has the molecular formula C28H23N3O4 and a molecular weight of 465.51 g/mol. Its IUPAC name is cyclopentene;ethyl 12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-13-carboxylate.
| Compound Name | cyclopentene;ethyl 12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-13-carboxylate |
|---|---|
| PubChem CID | 142254258 |
| Molecular Formula | C28H23N3O4 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | cyclopentene;ethyl 12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-13-carboxylate |
| SMILES | C1=CCCC1.CCOC(=O)N1C(=O)c2c(c3c4ccccc4[nH]c3c3[nH]c4ccccc4c23)C1=O |
| InChI | InChI=1S/C23H15N3O4.C5H8/c1-2-30-23(29)26-21(27)17-15-11-7-3-5-9-13(11)24-19(15)20-16(18(17)22(26)28)12-8-4-6-10-14(12)25-20;1-2-4-5-3-1/h3-10,24-25H,2H2,1H3;1-2H,3-5H2 |
| InChIKey | NXARCRBRBDDAGM-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|