C23H25ClN4O3 — CID 72707163
9-[(2S)-2,6-diaminohexanoyl]-9,19-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13,15,17-hexaene-8,10-dione;hydrochloride (PubChem CID 72707163) has the molecular formula C23H25ClN4O3 and a molecular weight of 440.93 g/mol. Its IUPAC name is 9-[(2S)-2,6-diaminohexanoyl]-9,19-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13,15,17-hexaene-8,10-dione;hydrochloride.
| Compound Name | 9-[(2S)-2,6-diaminohexanoyl]-9,19-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13,15,17-hexaene-8,10-dione;hydrochloride |
|---|---|
| PubChem CID | 72707163 |
| Molecular Formula | C23H25ClN4O3 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 9-[(2S)-2,6-diaminohexanoyl]-9,19-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13,15,17-hexaene-8,10-dione;hydrochloride |
| SMILES | Cl.NCCCC[C@H](N)C(=O)N1C(=O)c2c3c(c4[nH]c5ccccc5c4c2C1=O)CCC3 |
| InChI | InChI=1S/C23H24N4O3.ClH/c24-11-4-3-9-15(25)21(28)27-22(29)18-12-7-5-8-13(12)20-17(19(18)23(27)30)14-6-1-2-10-16(14)26-20;/h1-2,6,10,15,26H,3-5,7-9,11,24-25H2;1H/t15-;/m0./s1 |
| InChIKey | OCJUSXCOLPXPKN-RSAXXLAASA-N |
| XLogP | 2.81 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|