C23H24N4O3 — CID 10179362
19-(2,6-diaminohexanoyl)-9,19-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13,15,17-hexaene-8,10-dione (PubChem CID 10179362) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 19-(2,6-diaminohexanoyl)-9,19-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13,15,17-hexaene-8,10-dione.
| Compound Name | 19-(2,6-diaminohexanoyl)-9,19-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13,15,17-hexaene-8,10-dione |
|---|---|
| PubChem CID | 10179362 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 19-(2,6-diaminohexanoyl)-9,19-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13,15,17-hexaene-8,10-dione |
| SMILES | NCCCCC(N)C(=O)n1c2ccccc2c2c3c(c4c(c21)CCC4)C(=O)NC3=O |
| InChI | InChI=1S/C23H24N4O3/c24-11-4-3-9-15(25)23(30)27-16-10-2-1-6-14(16)17-19-18(21(28)26-22(19)29)12-7-5-8-13(12)20(17)27/h1-2,6,10,15H,3-5,7-9,11,24-25H2,(H,26,28,29) |
| InChIKey | GVRJWIBVPBFAII-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 120.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|