C20H36N2O — CID 54809503
N-(3-hexoxyphenyl)-N',N'-dipropylethane-1,2-diamine (PubChem CID 54809503) has the molecular formula C20H36N2O and a molecular weight of 320.52 g/mol. Its IUPAC name is N-(3-hexoxyphenyl)-N',N'-dipropylethane-1,2-diamine.
| Compound Name | N-(3-hexoxyphenyl)-N',N'-dipropylethane-1,2-diamine |
|---|---|
| PubChem CID | 54809503 |
| Molecular Formula | C20H36N2O |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.28 |
| IUPAC Name | N-(3-hexoxyphenyl)-N',N'-dipropylethane-1,2-diamine |
| SMILES | CCCCCCOc1cccc(NCCN(CCC)CCC)c1 |
| InChI | InChI=1S/C20H36N2O/c1-4-7-8-9-17-23-20-12-10-11-19(18-20)21-13-16-22(14-5-2)15-6-3/h10-12,18,21H,4-9,13-17H2,1-3H3 |
| InChIKey | QDNUGDPORRWVMD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|