C22H20Cl2N2O2 — CID 54810862
2-(2,4-dichloroanilino)-N-[3-(2-phenylethoxy)phenyl]acetamide (PubChem CID 54810862) has the molecular formula C22H20Cl2N2O2 and a molecular weight of 415.32 g/mol. Its IUPAC name is 2-(2,4-dichloroanilino)-N-[3-(2-phenylethoxy)phenyl]acetamide.
| Compound Name | 2-(2,4-dichloroanilino)-N-[3-(2-phenylethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 54810862 |
| Molecular Formula | C22H20Cl2N2O2 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 2-(2,4-dichloroanilino)-N-[3-(2-phenylethoxy)phenyl]acetamide |
| SMILES | O=C(CNc1ccc(Cl)cc1Cl)Nc1cccc(OCCc2ccccc2)c1 |
| InChI | InChI=1S/C22H20Cl2N2O2/c23-17-9-10-21(20(24)13-17)25-15-22(27)26-18-7-4-8-19(14-18)28-12-11-16-5-2-1-3-6-16/h1-10,13-14,25H,11-12,15H2,(H,26,27) |
| InChIKey | OKOQPEMHZUKZSO-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |