C17H21N3O3 — CID 54818705
N-[4-[[2-(furan-2-ylmethylamino)acetyl]amino]phenyl]butanamide (PubChem CID 54818705) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-[4-[[2-(furan-2-ylmethylamino)acetyl]amino]phenyl]butanamide.
| Compound Name | N-[4-[[2-(furan-2-ylmethylamino)acetyl]amino]phenyl]butanamide |
|---|---|
| PubChem CID | 54818705 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-[4-[[2-(furan-2-ylmethylamino)acetyl]amino]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(NC(=O)CNCc2ccco2)cc1 |
| InChI | InChI=1S/C17H21N3O3/c1-2-4-16(21)19-13-6-8-14(9-7-13)20-17(22)12-18-11-15-5-3-10-23-15/h3,5-10,18H,2,4,11-12H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | ZALRCZLLCHCGEW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |