C22H27N3O3 — CID 54821547
N-butyl-3-[[2-(4-prop-2-enoxyanilino)acetyl]amino]benzamide (PubChem CID 54821547) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-butyl-3-[[2-(4-prop-2-enoxyanilino)acetyl]amino]benzamide.
| Compound Name | N-butyl-3-[[2-(4-prop-2-enoxyanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54821547 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-butyl-3-[[2-(4-prop-2-enoxyanilino)acetyl]amino]benzamide |
| SMILES | C=CCOc1ccc(NCC(=O)Nc2cccc(C(=O)NCCCC)c2)cc1 |
| InChI | InChI=1S/C22H27N3O3/c1-3-5-13-23-22(27)17-7-6-8-19(15-17)25-21(26)16-24-18-9-11-20(12-10-18)28-14-4-2/h4,6-12,15,24H,2-3,5,13-14,16H2,1H3,(H,23,27)(H,25,26) |
| InChIKey | UFUDVZOYOWFAIF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|