C26H29N3O3 — CID 54823941
N-[2-methyl-3-[[2-[4-(2-phenylethoxy)anilino]acetyl]amino]phenyl]propanamide (PubChem CID 54823941) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is N-[2-methyl-3-[[2-[4-(2-phenylethoxy)anilino]acetyl]amino]phenyl]propanamide.
| Compound Name | N-[2-methyl-3-[[2-[4-(2-phenylethoxy)anilino]acetyl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 54823941 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | N-[2-methyl-3-[[2-[4-(2-phenylethoxy)anilino]acetyl]amino]phenyl]propanamide |
| SMILES | CCC(=O)Nc1cccc(NC(=O)CNc2ccc(OCCc3ccccc3)cc2)c1C |
| InChI | InChI=1S/C26H29N3O3/c1-3-25(30)28-23-10-7-11-24(19(23)2)29-26(31)18-27-21-12-14-22(15-13-21)32-17-16-20-8-5-4-6-9-20/h4-15,27H,3,16-18H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | FGIKMTYCAZUZQD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|