C15H22N2O2 — CID 54824487
N,N-diethyl-2-(2-prop-2-enoxyanilino)acetamide (PubChem CID 54824487) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is N,N-diethyl-2-(2-prop-2-enoxyanilino)acetamide.
| Compound Name | N,N-diethyl-2-(2-prop-2-enoxyanilino)acetamide |
|---|---|
| PubChem CID | 54824487 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N,N-diethyl-2-(2-prop-2-enoxyanilino)acetamide |
| SMILES | C=CCOc1ccccc1NCC(=O)N(CC)CC |
| InChI | InChI=1S/C15H22N2O2/c1-4-11-19-14-10-8-7-9-13(14)16-12-15(18)17(5-2)6-3/h4,7-10,16H,1,5-6,11-12H2,2-3H3 |
| InChIKey | XPTZUCAHQYINIL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|